C13H14Cl2O2 — CID 82093437
(Z)-3-[(2,4-dichlorophenyl)methyl]-4-methylpent-2-enoic acid (PubChem CID 82093437) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is (Z)-3-[(2,4-dichlorophenyl)methyl]-4-methylpent-2-enoic acid.
| Compound Name | (Z)-3-[(2,4-dichlorophenyl)methyl]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 82093437 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (Z)-3-[(2,4-dichlorophenyl)methyl]-4-methylpent-2-enoic acid |
| SMILES | CC(C)/C(=C\C(=O)O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O2/c1-8(2)10(6-13(16)17)5-9-3-4-11(14)7-12(9)15/h3-4,6-8H,5H2,1-2H3,(H,16,17)/b10-6- |
| InChIKey | PRIHJFYUXKCKSZ-POHAHGRESA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|