C12H11Cl2N3O2S2 — CID 11810612
6-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylsulfanyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 11810612) has the molecular formula C12H11Cl2N3O2S2 and a molecular weight of 364.28 g/mol. Its IUPAC name is 6-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylsulfanyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylsulfanyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 11810612 |
| Molecular Formula | C12H11Cl2N3O2S2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 6-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethylsulfanyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(SCCSCc2ccc(Cl)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11Cl2N3O2S2/c13-8-2-1-7(9(14)5-8)6-20-3-4-21-11-10(18)15-12(19)17-16-11/h1-2,5H,3-4,6H2,(H2,15,17,18,19) |
| InChIKey | YJWMXYMAKXCZAY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|