C11H8BrCl2N3O2 — CID 90036330
6-bromo-2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazine-3,5-dione (PubChem CID 90036330) has the molecular formula C11H8BrCl2N3O2 and a molecular weight of 365.01 g/mol. Its IUPAC name is 6-bromo-2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-bromo-2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 90036330 |
| Molecular Formula | C11H8BrCl2N3O2 |
| Molecular Weight | 365.01 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 6-bromo-2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(CCc2ccc(Cl)cc2Cl)nc1Br |
| InChI | InChI=1S/C11H8BrCl2N3O2/c12-9-10(18)15-11(19)17(16-9)4-3-6-1-2-7(13)5-8(6)14/h1-2,5H,3-4H2,(H,15,18,19) |
| InChIKey | XPMHHLHROORDLL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.01 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |