C11H9Cl2N3O3 — CID 73295703
2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazinane-3,5,6-trione (PubChem CID 73295703) has the molecular formula C11H9Cl2N3O3 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazinane-3,5,6-trione.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazinane-3,5,6-trione |
|---|---|
| PubChem CID | 73295703 |
| Molecular Formula | C11H9Cl2N3O3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazinane-3,5,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCc2ccc(Cl)cc2Cl)[nH]c1=O |
| InChI | InChI=1S/C11H9Cl2N3O3/c12-7-2-1-6(8(13)5-7)3-4-16-11(19)14-9(17)10(18)15-16/h1-2,5H,3-4H2,(H,15,18)(H,14,17,19) |
| InChIKey | MSFHPLQJTFGRHD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|