About 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one
6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 46201828) has the molecular formula C12H11Cl2N3OS
and a molecular weight of 316.21 g/mol. Its IUPAC name is 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one.
Molecular Properties
| Compound Name | 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one |
| PubChem CID | 46201828 |
| Molecular Formula | C12H11Cl2N3OS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | Nc1cc(=O)[nH]c(=S)n1CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3OS/c13-8-2-1-7(9(14)5-8)3-4-17-10(15)6-11(18)16-12(17)19/h1-2,5-6H,3-4,15H2,(H,16,18,19) |
| InChIKey | YVBBBCMIDKDAQH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one?
The IUPAC name of 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one (CID 46201828) is 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one.
What is the SMILES notation for 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one?
The canonical SMILES for 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one is Nc1cc(=O)[nH]c(=S)n1CCc1ccc(Cl)cc1Cl.
What is the InChIKey of 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one?
The InChIKey is YVBBBCMIDKDAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N3OS/c13-8-2-1-7(9(14)5-8)3-4-17-10(15)6-11(18)16-12(17)19/h1-2,5-6H,3-4,15H2,(H,16,18,19).
What are the key properties of 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one?
6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one has a molecular weight of 316.21 g/mol, XLogP of 3.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-[2-(2,4-dichlorophenyl)ethyl]-2-sulfanylidenepyrimidin-4-one is sourced from PubChem (CID 46201828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).