C12H12Cl2N2S — CID 81339310
3-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-1H-imidazole-2-thione (PubChem CID 81339310) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.22 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81339310 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2S/c1-8-7-15-12(17)16(8)5-4-9-2-3-10(13)6-11(9)14/h2-3,6-7H,4-5H2,1H3,(H,15,17) |
| InChIKey | QWTVEZVFMVJHJC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|