C11H9Cl2N3OS — CID 5295802
4-[(2,4-dichlorophenyl)methyl]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 5295802) has the molecular formula C11H9Cl2N3OS and a molecular weight of 302.19 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methyl]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-[(2,4-dichlorophenyl)methyl]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 5295802 |
| Molecular Formula | C11H9Cl2N3OS |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methyl]-6-methyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Cc1n[nH]c(=S)n(Cc2ccc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C11H9Cl2N3OS/c1-6-10(17)16(11(18)15-14-6)5-7-2-3-8(12)4-9(7)13/h2-4H,5H2,1H3,(H,15,18) |
| InChIKey | XUGDHISDQCQVLZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|