C17H25N — CID 143737435
(E)-6-(2,4-dimethylphenyl)-N-ethenyl-2-methylhex-1-en-1-amine (PubChem CID 143737435) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (E)-6-(2,4-dimethylphenyl)-N-ethenyl-2-methylhex-1-en-1-amine.
| Compound Name | (E)-6-(2,4-dimethylphenyl)-N-ethenyl-2-methylhex-1-en-1-amine |
|---|---|
| PubChem CID | 143737435 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (E)-6-(2,4-dimethylphenyl)-N-ethenyl-2-methylhex-1-en-1-amine |
| SMILES | C=CN/C=C(\C)CCCCc1ccc(C)cc1C |
| InChI | InChI=1S/C17H25N/c1-5-18-13-15(3)8-6-7-9-17-11-10-14(2)12-16(17)4/h5,10-13,18H,1,6-9H2,2-4H3/b15-13+ |
| InChIKey | DKSKAAGDHVDMIT-FYWRMAATSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|