C13H22IN — CID 145450537
3-(2,4-dimethylphenyl)-N-iodopropan-1-amine;ethane (PubChem CID 145450537) has the molecular formula C13H22IN and a molecular weight of 319.23 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N-iodopropan-1-amine;ethane.
| Compound Name | 3-(2,4-dimethylphenyl)-N-iodopropan-1-amine;ethane |
|---|---|
| PubChem CID | 145450537 |
| Molecular Formula | C13H22IN |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N-iodopropan-1-amine;ethane |
| SMILES | CC.Cc1ccc(CCCNI)c(C)c1 |
| InChI | InChI=1S/C11H16IN.C2H6/c1-9-5-6-11(10(2)8-9)4-3-7-13-12;1-2/h5-6,8,13H,3-4,7H2,1-2H3;1-2H3 |
| InChIKey | INJRBBWEZWFZTG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|