C19H32N2 — CID 137383468
1-(4,4-dimethylhex-1-en-2-yl)-2-[3-(2,4-dimethylphenyl)propyl]hydrazine (PubChem CID 137383468) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-(4,4-dimethylhex-1-en-2-yl)-2-[3-(2,4-dimethylphenyl)propyl]hydrazine.
| Compound Name | 1-(4,4-dimethylhex-1-en-2-yl)-2-[3-(2,4-dimethylphenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 137383468 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-(4,4-dimethylhex-1-en-2-yl)-2-[3-(2,4-dimethylphenyl)propyl]hydrazine |
| SMILES | C=C(CC(C)(C)CC)NNCCCc1ccc(C)cc1C |
| InChI | InChI=1S/C19H32N2/c1-7-19(5,6)14-17(4)21-20-12-8-9-18-11-10-15(2)13-16(18)3/h10-11,13,20-21H,4,7-9,12,14H2,1-3,5-6H3 |
| InChIKey | YUFQJTPCMVDJQB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|