C18H23NOS — CID 24550071
N-[3-(2,4-dimethylphenyl)propyl]-2,5-dimethylthiophene-3-carboxamide (PubChem CID 24550071) has the molecular formula C18H23NOS and a molecular weight of 301.46 g/mol. Its IUPAC name is N-[3-(2,4-dimethylphenyl)propyl]-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-[3-(2,4-dimethylphenyl)propyl]-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 24550071 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[3-(2,4-dimethylphenyl)propyl]-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1ccc(CCCNC(=O)c2cc(C)sc2C)c(C)c1 |
| InChI | InChI=1S/C18H23NOS/c1-12-7-8-16(13(2)10-12)6-5-9-19-18(20)17-11-14(3)21-15(17)4/h7-8,10-11H,5-6,9H2,1-4H3,(H,19,20) |
| InChIKey | FHGOYVRURDSRNQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|