C17H20FNO2S — CID 32644414
N-[4-(4-fluorophenoxy)butyl]-2,5-dimethylthiophene-3-carboxamide (PubChem CID 32644414) has the molecular formula C17H20FNO2S and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 32644414 |
| Molecular Formula | C17H20FNO2S |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCOc2ccc(F)cc2)c(C)s1 |
| InChI | InChI=1S/C17H20FNO2S/c1-12-11-16(13(2)22-12)17(20)19-9-3-4-10-21-15-7-5-14(18)6-8-15/h5-8,11H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | IQRNOJSAAWBBGR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|