C20H21BrF2N2O3 — CID 55793280
2-bromo-5-fluoro-N-[3-[4-(4-fluorophenoxy)butylamino]-3-oxopropyl]benzamide (PubChem CID 55793280) has the molecular formula C20H21BrF2N2O3 and a molecular weight of 455.30 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-[3-[4-(4-fluorophenoxy)butylamino]-3-oxopropyl]benzamide.
| Compound Name | 2-bromo-5-fluoro-N-[3-[4-(4-fluorophenoxy)butylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 55793280 |
| Molecular Formula | C20H21BrF2N2O3 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 2-bromo-5-fluoro-N-[3-[4-(4-fluorophenoxy)butylamino]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1cc(F)ccc1Br)NCCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21BrF2N2O3/c21-18-8-5-15(23)13-17(18)20(27)25-11-9-19(26)24-10-1-2-12-28-16-6-3-14(22)4-7-16/h3-8,13H,1-2,9-12H2,(H,24,26)(H,25,27) |
| InChIKey | YKKPNOLGTWCSAC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|