C19H25BrFN3O3 — CID 55805759
2-bromo-N-[3-[2-(cyclohexanecarbonylamino)ethylamino]-3-oxopropyl]-5-fluorobenzamide (PubChem CID 55805759) has the molecular formula C19H25BrFN3O3 and a molecular weight of 442.33 g/mol. Its IUPAC name is 2-bromo-N-[3-[2-(cyclohexanecarbonylamino)ethylamino]-3-oxopropyl]-5-fluorobenzamide.
| Compound Name | 2-bromo-N-[3-[2-(cyclohexanecarbonylamino)ethylamino]-3-oxopropyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 55805759 |
| Molecular Formula | C19H25BrFN3O3 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-bromo-N-[3-[2-(cyclohexanecarbonylamino)ethylamino]-3-oxopropyl]-5-fluorobenzamide |
| SMILES | O=C(CCNC(=O)c1cc(F)ccc1Br)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H25BrFN3O3/c20-16-7-6-14(21)12-15(16)19(27)23-9-8-17(25)22-10-11-24-18(26)13-4-2-1-3-5-13/h6-7,12-13H,1-5,8-11H2,(H,22,25)(H,23,27)(H,24,26) |
| InChIKey | SAWKVGYVIJFDIP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|