C17H18FNO2 — CID 37362583
N-[2-(4-fluorophenoxy)ethyl]-2,3-dimethylbenzamide (PubChem CID 37362583) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-2,3-dimethylbenzamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 37362583 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCOc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C17H18FNO2/c1-12-4-3-5-16(13(12)2)17(20)19-10-11-21-15-8-6-14(18)7-9-15/h3-9H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | SBGSFXWBLGZLTR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|