C16H17FN2O4S — CID 32645860
N-[4-(4-fluorophenoxy)butyl]-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 32645860) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 32645860 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCCCCOc2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17FN2O4S/c1-11-14(19(21)22)10-15(24-11)16(20)18-8-2-3-9-23-13-6-4-12(17)5-7-13/h4-7,10H,2-3,8-9H2,1H3,(H,18,20) |
| InChIKey | GNWJKVWVZQPALK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|