C17H31P — CID 143738826
1,2-diethyl-4-methylbenzene;ethane;methyl(prop-1-en-2-yl)phosphane (PubChem CID 143738826) has the molecular formula C17H31P and a molecular weight of 266.41 g/mol. Its IUPAC name is 1,2-diethyl-4-methylbenzene;ethane;methyl(prop-1-en-2-yl)phosphane.
| Compound Name | 1,2-diethyl-4-methylbenzene;ethane;methyl(prop-1-en-2-yl)phosphane |
|---|---|
| PubChem CID | 143738826 |
| Molecular Formula | C17H31P |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1,2-diethyl-4-methylbenzene;ethane;methyl(prop-1-en-2-yl)phosphane |
| SMILES | C=C(C)PC.CC.CCc1ccc(C)cc1CC |
| InChI | InChI=1S/C11H16.C4H9P.C2H6/c1-4-10-7-6-9(3)8-11(10)5-2;1-4(2)5-3;1-2/h6-8H,4-5H2,1-3H3;5H,1H2,2-3H3;1-2H3 |
| InChIKey | XXPREISZLHFQOM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|