About N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene
N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene (PubChem CID 142479341) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene.
Molecular Properties
| Compound Name | N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene |
| PubChem CID | 142479341 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene |
| SMILES | CCNC.Cc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14.C3H9N/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-3-4-2/h3-10H,1-2H3;4H,3H2,1-2H3 |
| InChIKey | NJAYJHJPZGDTGH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene?
The IUPAC name of N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene (CID 142479341) is N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene.
What is the SMILES notation for N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene?
The canonical SMILES for N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene is CCNC.Cc1ccc(-c2ccc(C)cc2)cc1.
What is the InChIKey of N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene?
The InChIKey is NJAYJHJPZGDTGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C3H9N/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-3-4-2/h3-10H,1-2H3;4H,3H2,1-2H3.
What are the key properties of N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene?
N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene has a molecular weight of 241.38 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanamine;1-methyl-4-(4-methylphenyl)benzene is sourced from PubChem (CID 142479341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).