C13H21N — CID 153363449
N-methylbut-3-en-1-amine;1,4-xylene (PubChem CID 153363449) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N-methylbut-3-en-1-amine;1,4-xylene.
| Compound Name | N-methylbut-3-en-1-amine;1,4-xylene |
|---|---|
| PubChem CID | 153363449 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-methylbut-3-en-1-amine;1,4-xylene |
| SMILES | C=CCCNC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C5H11N/c1-7-3-5-8(2)6-4-7;1-3-4-5-6-2/h3-6H,1-2H3;3,6H,1,4-5H2,2H3 |
| InChIKey | VQPDGFDSGUOOQQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|