C19H30N2O2S — CID 67936482
N-but-3-enyl-N'-[4-(4-methylphenyl)sulfonylbut-3-enyl]butane-1,4-diamine (PubChem CID 67936482) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is N-but-3-enyl-N'-[4-(4-methylphenyl)sulfonylbut-3-enyl]butane-1,4-diamine.
| Compound Name | N-but-3-enyl-N'-[4-(4-methylphenyl)sulfonylbut-3-enyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 67936482 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-but-3-enyl-N'-[4-(4-methylphenyl)sulfonylbut-3-enyl]butane-1,4-diamine |
| SMILES | C=CCCNCCCCNCCC=CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H30N2O2S/c1-3-4-13-20-14-5-6-15-21-16-7-8-17-24(22,23)19-11-9-18(2)10-12-19/h3,8-12,17,20-21H,1,4-7,13-16H2,2H3 |
| InChIKey | GRQXZDZZRJQMGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|