About (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol
(E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol (PubChem CID 15358133) has the molecular formula C17H26O3S
and a molecular weight of 310.46 g/mol. Its IUPAC name is (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol.
Molecular Properties
| Compound Name | (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol |
| PubChem CID | 15358133 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/CCCC(O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26O3S/c1-14-9-11-15(12-10-14)21(19,20)13-7-5-6-8-16(18)17(2,3)4/h7,9-13,16,18H,5-6,8H2,1-4H3/b13-7+ |
| InChIKey | FABJTIFHLWOXHM-NTUHNPAUSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol?
The IUPAC name of (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol (CID 15358133) is (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol.
What is the SMILES notation for (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol?
The canonical SMILES for (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol is Cc1ccc(S(=O)(=O)/C=C/CCCC(O)C(C)(C)C)cc1.
What is the InChIKey of (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol?
The InChIKey is FABJTIFHLWOXHM-NTUHNPAUSA-N. The full InChI is InChI=1S/C17H26O3S/c1-14-9-11-15(12-10-14)21(19,20)13-7-5-6-8-16(18)17(2,3)4/h7,9-13,16,18H,5-6,8H2,1-4H3/b13-7+.
What are the key properties of (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol?
(E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol has a molecular weight of 310.46 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,2-dimethyl-8-(4-methylphenyl)sulfonyloct-7-en-3-ol is sourced from PubChem (CID 15358133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).