C18H26O3S — CID 15358136
(E)-1-cyclohexyl-5-(4-methylphenyl)sulfonylpent-4-en-1-ol (PubChem CID 15358136) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is (E)-1-cyclohexyl-5-(4-methylphenyl)sulfonylpent-4-en-1-ol.
| Compound Name | (E)-1-cyclohexyl-5-(4-methylphenyl)sulfonylpent-4-en-1-ol |
|---|---|
| PubChem CID | 15358136 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (E)-1-cyclohexyl-5-(4-methylphenyl)sulfonylpent-4-en-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/CCC(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26O3S/c1-15-10-12-17(13-11-15)22(20,21)14-6-5-9-18(19)16-7-3-2-4-8-16/h6,10-14,16,18-19H,2-5,7-9H2,1H3/b14-6+ |
| InChIKey | DNFLVOZHMNEATJ-MKMNVTDBSA-N |
| XLogP | 4.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |