C10H10ClFO2S — CID 105424847
2-(3-chloro-4-methylsulfanylphenyl)-2-fluoropropanoic acid (PubChem CID 105424847) has the molecular formula C10H10ClFO2S and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-(3-chloro-4-methylsulfanylphenyl)-2-fluoropropanoic acid.
| Compound Name | 2-(3-chloro-4-methylsulfanylphenyl)-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 105424847 |
| Molecular Formula | C10H10ClFO2S |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2-(3-chloro-4-methylsulfanylphenyl)-2-fluoropropanoic acid |
| SMILES | CSc1ccc(C(C)(F)C(=O)O)cc1Cl |
| InChI | InChI=1S/C10H10ClFO2S/c1-10(12,9(13)14)6-3-4-8(15-2)7(11)5-6/h3-5H,1-2H3,(H,13,14) |
| InChIKey | XMFRBLIYEZNXCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |