About [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate
[1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate (PubChem CID 57152218) has the molecular formula C16H19ClN2O3S
and a molecular weight of 354.86 g/mol. Its IUPAC name is [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate |
| PubChem CID | 57152218 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CN)(CN)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-12-2-8-15(9-3-12)23(20,21)22-16(10-18,11-19)13-4-6-14(17)7-5-13/h2-9H,10-11,18-19H2,1H3 |
| InChIKey | BDKFLMDWJWFMJL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate?
The IUPAC name of [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate (CID 57152218) is [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate.
What is the SMILES notation for [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate?
The canonical SMILES for [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC(CN)(CN)c2ccc(Cl)cc2)cc1.
What is the InChIKey of [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate?
The InChIKey is BDKFLMDWJWFMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O3S/c1-12-2-8-15(9-3-12)23(20,21)22-16(10-18,11-19)13-4-6-14(17)7-5-13/h2-9H,10-11,18-19H2,1H3.
What are the key properties of [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate?
[1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate has a molecular weight of 354.86 g/mol, XLogP of 2.17, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate is sourced from PubChem (CID 57152218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).