C16H19ClN2O3S — CID 57152218
[1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate (PubChem CID 57152218) has the molecular formula C16H19ClN2O3S and a molecular weight of 354.86 g/mol. Its IUPAC name is [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57152218 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [1,3-diamino-2-(4-chlorophenyl)propan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CN)(CN)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-12-2-8-15(9-3-12)23(20,21)22-16(10-18,11-19)13-4-6-14(17)7-5-13/h2-9H,10-11,18-19H2,1H3 |
| InChIKey | BDKFLMDWJWFMJL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|