C25H33NO5S — CID 118492134
[5-[[(1E)-1-ethoxyimino-2,3-dihydroinden-5-yl]oxy]-3,3-dimethylpentyl] 4-methylbenzenesulfonate (PubChem CID 118492134) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is [5-[[(1E)-1-ethoxyimino-2,3-dihydroinden-5-yl]oxy]-3,3-dimethylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [5-[[(1E)-1-ethoxyimino-2,3-dihydroinden-5-yl]oxy]-3,3-dimethylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118492134 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | [5-[[(1E)-1-ethoxyimino-2,3-dihydroinden-5-yl]oxy]-3,3-dimethylpentyl] 4-methylbenzenesulfonate |
| SMILES | CCO/N=C1\CCc2cc(OCCC(C)(C)CCOS(=O)(=O)c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C25H33NO5S/c1-5-30-26-24-13-8-20-18-21(9-12-23(20)24)29-16-14-25(3,4)15-17-31-32(27,28)22-10-6-19(2)7-11-22/h6-7,9-12,18H,5,8,13-17H2,1-4H3/b26-24+ |
| InChIKey | CCYPVYLKIACSPY-SHHOIMCASA-N |
| XLogP | 5.27 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|