C18H15F15O5S — CID 18995379
[5,5-difluoro-5-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentyl] 4-methylbenzenesulfonate (PubChem CID 18995379) has the molecular formula C18H15F15O5S and a molecular weight of 628.35 g/mol. Its IUPAC name is [5,5-difluoro-5-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentyl] 4-methylbenzenesulfonate.
| Compound Name | [5,5-difluoro-5-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 18995379 |
| Molecular Formula | C18H15F15O5S |
| Molecular Weight | 628.35 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | [5,5-difluoro-5-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F15O5S/c1-10-4-6-11(7-5-10)39(34,35)36-9-3-2-8-12(19,20)37-17(30,31)18(32,33)38-16(28,29)14(23,24)13(21,22)15(25,26)27/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | OIQAOEMGFRHJQS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.35 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|