C17H16N2O7S2 — CID 138392453
2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl 4-methylbenzenesulfonate (PubChem CID 138392453) has the molecular formula C17H16N2O7S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138392453 |
| Molecular Formula | C17H16N2O7S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2nonc2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O7S2/c1-13-7-9-15(10-8-13)28(22,23)25-12-11-24-16-17(19-26-18-16)27(20,21)14-5-3-2-4-6-14/h2-10H,11-12H2,1H3 |
| InChIKey | ZYINUKJGXOTNEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 125.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|