C31H36O5S — CID 58880752
(4-hydroxy-3-methoxybutyl) 4-[(E)-2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]benzenesulfonate (PubChem CID 58880752) has the molecular formula C31H36O5S and a molecular weight of 520.69 g/mol. Its IUPAC name is (4-hydroxy-3-methoxybutyl) 4-[(E)-2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]benzenesulfonate.
| Compound Name | (4-hydroxy-3-methoxybutyl) 4-[(E)-2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 58880752 |
| Molecular Formula | C31H36O5S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (4-hydroxy-3-methoxybutyl) 4-[(E)-2-[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]benzenesulfonate |
| SMILES | COC(CO)CCOS(=O)(=O)c1ccc(/C=C/c2ccc(/C=C/c3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H36O5S/c1-31(2,3)28-17-13-26(14-18-28)11-9-24-5-7-25(8-6-24)10-12-27-15-19-30(20-16-27)37(33,34)36-22-21-29(23-32)35-4/h5-20,29,32H,21-23H2,1-4H3/b11-9+,12-10+ |
| InChIKey | CTEHCNPADHFGMS-WGDLNXRISA-N |
| XLogP | 6.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|