C23H20N2O8S — CID 43009573
[4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)carbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 43009573) has the molecular formula C23H20N2O8S and a molecular weight of 484.49 g/mol. Its IUPAC name is [4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)carbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)carbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 43009573 |
| Molecular Formula | C23H20N2O8S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | [4-[2,3-dihydro-1,4-benzodioxin-3-ylmethyl(methyl)carbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | CN(CC1COc2ccccc2O1)C(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H20N2O8S/c1-24(14-19-15-31-21-7-2-3-8-22(21)32-19)23(26)16-9-11-18(12-10-16)33-34(29,30)20-6-4-5-17(13-20)25(27)28/h2-13,19H,14-15H2,1H3 |
| InChIKey | TXPHCNAPPMAKBE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|