C17H15ClN2O5 — CID 51873110
4-chloro-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-nitrobenzamide (PubChem CID 51873110) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is 4-chloro-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 51873110 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-chloro-N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-methyl-2-nitrobenzamide |
| SMILES | CN(C[C@H]1COc2ccccc2O1)C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15ClN2O5/c1-19(9-12-10-24-15-4-2-3-5-16(15)25-12)17(21)13-7-6-11(18)8-14(13)20(22)23/h2-8,12H,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | JIIFLVIZNSAQJF-LBPRGKRZSA-N |
| XLogP | 3.16 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|