C18H17ClN2O5 — CID 97329069
3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-ethyl-4-nitrobenzamide (PubChem CID 97329069) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is 3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-ethyl-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-ethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 97329069 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-chloro-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-N-ethyl-4-nitrobenzamide |
| SMILES | CCN(C[C@@H]1COc2ccccc2O1)C(=O)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O5/c1-2-20(10-13-11-25-16-5-3-4-6-17(16)26-13)18(22)12-7-8-15(21(23)24)14(19)9-12/h3-9,13H,2,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | APWACQCVEDLBQU-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|