C21H22N4O4S — CID 174575129
benzyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate;nitrobenzene (PubChem CID 174575129) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is benzyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate;nitrobenzene.
| Compound Name | benzyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate;nitrobenzene |
|---|---|
| PubChem CID | 174575129 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | benzyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate;nitrobenzene |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2nccs2)CC1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C15H17N3O2S.C6H5NO2/c19-15(20-12-13-4-2-1-3-5-13)18-9-7-17(8-10-18)14-16-6-11-21-14;8-7(9)6-4-2-1-3-5-6/h1-6,11H,7-10,12H2;1-5H |
| InChIKey | BDDHEZRWEWEYKV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|