About [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate
[4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate (PubChem CID 31188132) has the molecular formula C24H21N3O7S
and a molecular weight of 495.51 g/mol. Its IUPAC name is [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate |
| PubChem CID | 31188132 |
| Molecular Formula | C24H21N3O7S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2ccc(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C24H21N3O7S/c28-23(18-5-2-1-3-6-18)25-13-15-26(16-14-25)24(29)19-9-11-21(12-10-19)34-35(32,33)22-8-4-7-20(17-22)27(30)31/h1-12,17H,13-16H2 |
| InChIKey | CYJPETAVMQQJLW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate?
The IUPAC name of [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate (CID 31188132) is [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate.
What is the SMILES notation for [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate?
The canonical SMILES for [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate is O=C(c1ccccc1)N1CCN(C(=O)c2ccc(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)CC1.
What is the InChIKey of [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate?
The InChIKey is CYJPETAVMQQJLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O7S/c28-23(18-5-2-1-3-6-18)25-13-15-26(16-14-25)24(29)19-9-11-21(12-10-19)34-35(32,33)22-8-4-7-20(17-22)27(30)31/h1-12,17H,13-16H2.
What are the key properties of [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate?
[4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate has a molecular weight of 495.51 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-benzoylpiperazine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate is sourced from PubChem (CID 31188132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).