C21H18N2O6S2 — CID 43004636
[4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate (PubChem CID 43004636) has the molecular formula C21H18N2O6S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is [4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 43004636 |
| Molecular Formula | C21H18N2O6S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | [4-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl] 3-nitrobenzenesulfonate |
| SMILES | O=C(c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C21H18N2O6S2/c24-21(22-12-2-6-19(22)20-7-3-13-30-20)15-8-10-17(11-9-15)29-31(27,28)18-5-1-4-16(14-18)23(25)26/h1,3-5,7-11,13-14,19H,2,6,12H2 |
| InChIKey | YBBASVHJCBEVLL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|