C14H24N2O2 — CID 176696090
N-(3,5-dimethoxyphenyl)pyrrolidin-3-amine;ethane (PubChem CID 176696090) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)pyrrolidin-3-amine;ethane.
| Compound Name | N-(3,5-dimethoxyphenyl)pyrrolidin-3-amine;ethane |
|---|---|
| PubChem CID | 176696090 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)pyrrolidin-3-amine;ethane |
| SMILES | CC.COc1cc(NC2CCNC2)cc(OC)c1 |
| InChI | InChI=1S/C12H18N2O2.C2H6/c1-15-11-5-10(6-12(7-11)16-2)14-9-3-4-13-8-9;1-2/h5-7,9,13-14H,3-4,8H2,1-2H3;1-2H3 |
| InChIKey | WSHVZMBBPIQNQR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |