C13H20N2O3 — CID 115118637
N-(2,4,6-trimethoxyphenyl)pyrrolidin-3-amine (PubChem CID 115118637) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(2,4,6-trimethoxyphenyl)pyrrolidin-3-amine.
| Compound Name | N-(2,4,6-trimethoxyphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115118637 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-(2,4,6-trimethoxyphenyl)pyrrolidin-3-amine |
| SMILES | COc1cc(OC)c(NC2CCNC2)c(OC)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-16-10-6-11(17-2)13(12(7-10)18-3)15-9-4-5-14-8-9/h6-7,9,14-15H,4-5,8H2,1-3H3 |
| InChIKey | BKHYFQVRFLBAMK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|