C15H20FN3O4 — CID 133341450
2-[1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylacetamide (PubChem CID 133341450) has the molecular formula C15H20FN3O4 and a molecular weight of 325.34 g/mol. Its IUPAC name is 2-[1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylacetamide.
| Compound Name | 2-[1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 133341450 |
| Molecular Formula | C15H20FN3O4 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[1-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1CCN(c2cc(OC)cc(F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H20FN3O4/c1-17-14(20)7-10-3-5-18(6-4-10)13-9-11(23-2)8-12(16)15(13)19(21)22/h8-10H,3-7H2,1-2H3,(H,17,20) |
| InChIKey | PBRIKGXDQAAOFO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|