C14H16FN5O3 — CID 133455633
1-(3-fluoro-5-methoxy-2-nitrophenyl)-4-(triazol-1-yl)piperidine (PubChem CID 133455633) has the molecular formula C14H16FN5O3 and a molecular weight of 321.31 g/mol. Its IUPAC name is 1-(3-fluoro-5-methoxy-2-nitrophenyl)-4-(triazol-1-yl)piperidine.
| Compound Name | 1-(3-fluoro-5-methoxy-2-nitrophenyl)-4-(triazol-1-yl)piperidine |
|---|---|
| PubChem CID | 133455633 |
| Molecular Formula | C14H16FN5O3 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-(3-fluoro-5-methoxy-2-nitrophenyl)-4-(triazol-1-yl)piperidine |
| SMILES | COc1cc(F)c([N+](=O)[O-])c(N2CCC(n3ccnn3)CC2)c1 |
| InChI | InChI=1S/C14H16FN5O3/c1-23-11-8-12(15)14(20(21)22)13(9-11)18-5-2-10(3-6-18)19-7-4-16-17-19/h4,7-10H,2-3,5-6H2,1H3 |
| InChIKey | AJDZWAUVRNKZRU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|