C10H10F2N2O3 — CID 113325746
1-(3,5-difluoro-2-nitrophenyl)pyrrolidin-3-ol (PubChem CID 113325746) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-nitrophenyl)pyrrolidin-3-ol.
| Compound Name | 1-(3,5-difluoro-2-nitrophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 113325746 |
| Molecular Formula | C10H10F2N2O3 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(3,5-difluoro-2-nitrophenyl)pyrrolidin-3-ol |
| SMILES | O=[N+]([O-])c1c(F)cc(F)cc1N1CCC(O)C1 |
| InChI | InChI=1S/C10H10F2N2O3/c11-6-3-8(12)10(14(16)17)9(4-6)13-2-1-7(15)5-13/h3-4,7,15H,1-2,5H2 |
| InChIKey | FJEJVEIXSASAPA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|