C13H17F2N3O2 — CID 115509750
1-[1-(3,5-difluoro-2-nitrophenyl)piperidin-3-yl]ethanamine (PubChem CID 115509750) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-[1-(3,5-difluoro-2-nitrophenyl)piperidin-3-yl]ethanamine.
| Compound Name | 1-[1-(3,5-difluoro-2-nitrophenyl)piperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 115509750 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[1-(3,5-difluoro-2-nitrophenyl)piperidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCCN(c2cc(F)cc(F)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H17F2N3O2/c1-8(16)9-3-2-4-17(7-9)12-6-10(14)5-11(15)13(12)18(19)20/h5-6,8-9H,2-4,7,16H2,1H3 |
| InChIKey | CCTXVQNYYYTZSG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|