C12H15F2N3O2 — CID 115507795
N-(3,5-difluoro-2-nitrophenyl)-1-methylpiperidin-3-amine (PubChem CID 115507795) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is N-(3,5-difluoro-2-nitrophenyl)-1-methylpiperidin-3-amine.
| Compound Name | N-(3,5-difluoro-2-nitrophenyl)-1-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 115507795 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(3,5-difluoro-2-nitrophenyl)-1-methylpiperidin-3-amine |
| SMILES | CN1CCCC(Nc2cc(F)cc(F)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H15F2N3O2/c1-16-4-2-3-9(7-16)15-11-6-8(13)5-10(14)12(11)17(18)19/h5-6,9,15H,2-4,7H2,1H3 |
| InChIKey | MTMHVCIXMHPKEV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|