C18H22FN5O3 — CID 133343808
1-(6-ethylpyrimidin-4-yl)-N-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine (PubChem CID 133343808) has the molecular formula C18H22FN5O3 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-(6-ethylpyrimidin-4-yl)-N-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine.
| Compound Name | 1-(6-ethylpyrimidin-4-yl)-N-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133343808 |
| Molecular Formula | C18H22FN5O3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-(6-ethylpyrimidin-4-yl)-N-(3-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-amine |
| SMILES | CCc1cc(N2CCC(Nc3cc(OC)cc(F)c3[N+](=O)[O-])CC2)ncn1 |
| InChI | InChI=1S/C18H22FN5O3/c1-3-12-8-17(21-11-20-12)23-6-4-13(5-7-23)22-16-10-14(27-2)9-15(19)18(16)24(25)26/h8-11,13,22H,3-7H2,1-2H3 |
| InChIKey | FRYAPMKOHNKKNM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|