C18H31N5O — CID 119897857
7-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]heptanamide (PubChem CID 119897857) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 7-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]heptanamide.
| Compound Name | 7-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]heptanamide |
|---|---|
| PubChem CID | 119897857 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 7-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]heptanamide |
| SMILES | CCc1cc(N2CCC(NC(=O)CCCCCCN)CC2)ncn1 |
| InChI | InChI=1S/C18H31N5O/c1-2-15-13-17(21-14-20-15)23-11-8-16(9-12-23)22-18(24)7-5-3-4-6-10-19/h13-14,16H,2-12,19H2,1H3,(H,22,24) |
| InChIKey | MNSNSPJFQPFIIM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|