C18H25Cl2N5O — CID 119947419
2-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]benzamide;dihydrochloride (PubChem CID 119947419) has the molecular formula C18H25Cl2N5O and a molecular weight of 398.34 g/mol. Its IUPAC name is 2-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119947419 |
| Molecular Formula | C18H25Cl2N5O |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]benzamide;dihydrochloride |
| SMILES | CCc1cc(N2CCC(NC(=O)c3ccccc3N)CC2)ncn1.Cl.Cl |
| InChI | InChI=1S/C18H23N5O.2ClH/c1-2-13-11-17(21-12-20-13)23-9-7-14(8-10-23)22-18(24)15-5-3-4-6-16(15)19;;/h3-6,11-12,14H,2,7-10,19H2,1H3,(H,22,24);2*1H |
| InChIKey | IHFVWTYLVVJPMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|