C21H30N6O2 — CID 167870558
N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]-5-methyl-1-(oxan-4-yl)pyrazole-4-carboxamide (PubChem CID 167870558) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]-5-methyl-1-(oxan-4-yl)pyrazole-4-carboxamide.
| Compound Name | N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]-5-methyl-1-(oxan-4-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167870558 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]-5-methyl-1-(oxan-4-yl)pyrazole-4-carboxamide |
| SMILES | CCc1cc(N2CCC(NC(=O)c3cnn(C4CCOCC4)c3C)CC2)ncn1 |
| InChI | InChI=1S/C21H30N6O2/c1-3-16-12-20(23-14-22-16)26-8-4-17(5-9-26)25-21(28)19-13-24-27(15(19)2)18-6-10-29-11-7-18/h12-14,17-18H,3-11H2,1-2H3,(H,25,28) |
| InChIKey | WBYYCJHCUIZQFY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |