C15H25N5O — CID 119897919
4-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]butanamide (PubChem CID 119897919) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]butanamide.
| Compound Name | 4-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 119897919 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-amino-N-[1-(6-ethylpyrimidin-4-yl)piperidin-4-yl]butanamide |
| SMILES | CCc1cc(N2CCC(NC(=O)CCCN)CC2)ncn1 |
| InChI | InChI=1S/C15H25N5O/c1-2-12-10-14(18-11-17-12)20-8-5-13(6-9-20)19-15(21)4-3-7-16/h10-11,13H,2-9,16H2,1H3,(H,19,21) |
| InChIKey | XHSSMTQPHOKBMW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |