About N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine
N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine (PubChem CID 133430448) has the molecular formula C15H17FN2O3
and a molecular weight of 292.31 g/mol. Its IUPAC name is N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine.
Molecular Properties
| Compound Name | N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine |
| PubChem CID | 133430448 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])c(NC2C3C4CCC(C4)C23)c1 |
| InChI | InChI=1S/C15H17FN2O3/c1-21-9-5-10(16)15(18(19)20)11(6-9)17-14-12-7-2-3-8(4-7)13(12)14/h5-8,12-14,17H,2-4H2,1H3 |
| InChIKey | FQWLNUDXQTUQAO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine?
The IUPAC name of N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine (CID 133430448) is N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine.
What is the SMILES notation for N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine?
The canonical SMILES for N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine is COc1cc(F)c([N+](=O)[O-])c(NC2C3C4CCC(C4)C23)c1.
What is the InChIKey of N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine?
The InChIKey is FQWLNUDXQTUQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O3/c1-21-9-5-10(16)15(18(19)20)11(6-9)17-14-12-7-2-3-8(4-7)13(12)14/h5-8,12-14,17H,2-4H2,1H3.
What are the key properties of N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine?
N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine has a molecular weight of 292.31 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluoro-5-methoxy-2-nitrophenyl)tricyclo[3.2.1.02,4]octan-3-amine is sourced from PubChem (CID 133430448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).