C14H17N3O4S — CID 129435736
2-nitro-3-[[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]amino]benzenesulfonamide (PubChem CID 129435736) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-nitro-3-[[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]amino]benzenesulfonamide.
| Compound Name | 2-nitro-3-[[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 129435736 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-nitro-3-[[(1S,2S,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NC2[C@H]3[C@H]4CC[C@@H](C4)[C@H]23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O4S/c15-22(20,21)10-3-1-2-9(14(10)17(18)19)16-13-11-7-4-5-8(6-7)12(11)13/h1-3,7-8,11-13,16H,4-6H2,(H2,15,20,21)/t7-,8-,11-,12-/m0/s1 |
| InChIKey | IKXVMQZCSAEJBO-OSTYVCCYSA-N |
| XLogP | 1.70 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|