C12H13N5O4S — CID 133466577
3-[[6-(methylamino)-3-pyridinyl]amino]-2-nitrobenzenesulfonamide (PubChem CID 133466577) has the molecular formula C12H13N5O4S and a molecular weight of 323.33 g/mol. Its IUPAC name is 3-[[6-(methylamino)-3-pyridinyl]amino]-2-nitrobenzenesulfonamide.
| Compound Name | 3-[[6-(methylamino)-3-pyridinyl]amino]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133466577 |
| Molecular Formula | C12H13N5O4S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 3-[[6-(methylamino)-3-pyridinyl]amino]-2-nitrobenzenesulfonamide |
| SMILES | CNc1ccc(Nc2cccc(S(N)(=O)=O)c2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H13N5O4S/c1-14-11-6-5-8(7-15-11)16-9-3-2-4-10(22(13,20)21)12(9)17(18)19/h2-7,16H,1H3,(H,14,15)(H2,13,20,21) |
| InChIKey | VWBHFXPBWQUPCX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|