C15H20N2 — CID 114095351
3-methyl-1-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,2-diamine (PubChem CID 114095351) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-methyl-1-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,2-diamine.
| Compound Name | 3-methyl-1-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 114095351 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-methyl-1-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,2-diamine |
| SMILES | Cc1cccc(NC2C3C4CCC(C4)C23)c1N |
| InChI | InChI=1S/C15H20N2/c1-8-3-2-4-11(14(8)16)17-15-12-9-5-6-10(7-9)13(12)15/h2-4,9-10,12-13,15,17H,5-7,16H2,1H3 |
| InChIKey | QJTIGRRXBZDCOW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|